cas: 31643-49-9 — see every product listed under this CAS number, including other names
4-Nitrophthalonitrile, >98.0%(GC) (CAS 31643-49-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N0524-25G |
| cas | 31643-49-9 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 216.69 Pln | |
| TCI | 100g | 585.48 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
4-nitrobenzene-1,2-dicarbonitrile (CAS 31643-49-9) is a chemical compound with the molecular formula C8H3N3O2 and a molecular weight of 173.13 g/mol. IUPAC name: 4-nitrobenzene-1,2-dicarbonitrile. InChIKey: NTZMSBAAHBICLE-UHFFFAOYSA-N.
| Molecular formula | C8H3N3O2 |
|---|---|
| Molecular weight | 173.13 g/mol |
| IUPAC name | 4-nitrobenzene-1,2-dicarbonitrile |
| InChIKey | NTZMSBAAHBICLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C#N)C#N |
Computed by PubChem (NCBI)