4-Nitrophthalonitrile, 99.99%
cas: 31643-49-9 — see every product listed under this CAS number, including other names
4-Nitrophthalonitrile, 99.99% (CAS 31643-49-9) is a chemical reagent available from Chemat. Available pack sizes: 500 g, 50 g, 10mM/1mL, 250 g, 100 g, 1000 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W018645-500 g |
| cas | 31643-49-9 |
| size | 500 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 500 g | 853.75 Pln | |
| MedChemExpress | 50 g | 263.96 Pln | |
| MedChemExpress | 10mM/1mL | 277.90 Pln | |
| MedChemExpress | 250 g | 598.33 Pln | |
| MedChemExpress | 100 g | 361.49 Pln | |
| MedChemExpress | 1000 g | 1225.27 Pln |
properties
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.99% |
4-nitrobenzene-1,2-dicarbonitrile (CAS 31643-49-9) is a chemical compound with the molecular formula C8H3N3O2 and a molecular weight of 173.13 g/mol. IUPAC name: 4-nitrobenzene-1,2-dicarbonitrile. InChIKey: NTZMSBAAHBICLE-UHFFFAOYSA-N.
| Molecular formula | C8H3N3O2 |
|---|---|
| Molecular weight | 173.13 g/mol |
| IUPAC name | 4-nitrobenzene-1,2-dicarbonitrile |
| InChIKey | NTZMSBAAHBICLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C#N)C#N |
Computed by PubChem (NCBI)
Synonyms:
4-Nitrophthalonitrile, 4-nitrobenzene-1,2-dicarbonitrile, 5-Nitrobenzene-1,2-dicarbonitrile, 4-Nitro-1,2-benzenedicarbonitrile, 3,4-Dicyanonitrobenzene, 1,2-Benzenedicarbonitrile, 4-nitro-, Phthalonitrile, 4-nitro-, 5-Nitro-1,2-benzenedicarbonitrile, 4-Nitro-phthalonitrile, 1,2-Dicyano-4-nitrobenzene