Products 53539-37-0
CAS 53539-37-0 appears in our catalog under these names: 4-O-p-Coumaroylquinic acid/ 99.8% (existing batch purity), 4–O–p–Coumaroylquinic acid, 4-O-P-COUMAROYLQUINIC ACID, 4-O-p-Coumaroylquinic acid, 99.80% ,, 99.80% ,, 4-O-p-Coumaroylquinic acid, 99.59%. Offered by: TargetMol, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 25 mg.
Trans-(3R,5R)-1,3,5-trihydroxy-4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid (CAS 53539-37-0) is a chemical compound with the molecular formula C16H18O8 and a molecular weight of 338.31 g/mol. IUPAC name: trans-(3R,5R)-1,3,5-trihydroxy-4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid. InChIKey: XWRHBGVVCOSNKO-OPGYGNEESA-N.
| Molecular formula | C16H18O8 |
|---|---|
| Molecular weight | 338.31 g/mol |
| IUPAC name | trans-(3R,5R)-1,3,5-trihydroxy-4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid |
| InChIKey | XWRHBGVVCOSNKO-OPGYGNEESA-N |
| SMILES | C1[C@H](C([C@@H](CC1(C(=O)O)O)O)OC(=O)/C=C/C2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)