CAS 3133-16-2 appears in our catalog under these names: 4-Octyl itaconate/ 99.87% (existing batch purity), 4–Octyl Itaconate, 4-Octyl itaconate, 4-Octyl Itaconate, >98.0%(GC)(T), Itaconic acid 4-octyl ester [4-Octyl itaconate]. Offered by: TargetMol, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 200mg, 500mg, 0,25g, 0,5g.
3-octan-4-yloxycarbonylbut-3-enoate (CAS 3133-16-2) is a chemical compound with the molecular formula C13H21O4- and a molecular weight of 241.30 g/mol. IUPAC name: 3-octan-4-yloxycarbonylbut-3-enoate. InChIKey: GIRJEIMINMHXQS-UHFFFAOYSA-M.
| Molecular formula | C13H21O4- |
|---|---|
| Molecular weight | 241.30 g/mol |
| IUPAC name | 3-octan-4-yloxycarbonylbut-3-enoate |
| InChIKey | GIRJEIMINMHXQS-UHFFFAOYSA-M |
| SMILES | CCCCC(CCC)OC(=O)C(=C)CC(=O)[O-] |
Computed by PubChem (NCBI)