cas: 1095952-22-9 — see every product listed under this CAS number, including other names
4-Oxazolidinecarboxylic acid, 3-[2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]acetyl]-2,2-dimethyl-, (4S)-, 98%, 98% (CAS 1095952-22-9) is a chemical reagent available from Chemat. Available pack sizes: 250g, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119T5F-250g |
| cas | 1095952-22-9 |
| size | 250g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250g | 10019.60 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 544.40 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1509.20 Pln | |
| Chemat | 50g | 2406.80 Pln | |
| Chemat | 100g | 4197.20 Pln | |
| Chemat | 500g | 17846.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4S)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid (CAS 1095952-22-9) is a chemical compound with the molecular formula C23H24N2O6 and a molecular weight of 424.4 g/mol. IUPAC name: (4S)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid. InChIKey: XUBXHZJERGBCEL-IBGZPJMESA-N.
| Molecular formula | C23H24N2O6 |
|---|---|
| Molecular weight | 424.4 g/mol |
| IUPAC name | (4S)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid |
| InChIKey | XUBXHZJERGBCEL-IBGZPJMESA-N |
| SMILES | CC1(N([C@@H](CO1)C(=O)O)C(=O)CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C |
Computed by PubChem (NCBI)