Fmoc-Gly-Ser(Psi(Me,Me)pro)-OH, 95%
cas: 1095952-22-9 — see every product listed under this CAS number, including other names
Fmoc-Gly-Ser(Psi(Me,Me)pro)-OH, 95% (CAS 1095952-22-9) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g, 10g, 25g, 100g, 250mg. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F981891-500MG |
| cas | 1095952-22-9 |
| size | 500mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 237.43 Pln | |
| Fluorochem | 1g | 242.64 Pln | |
| Fluorochem | 5g | 841.39 Pln | |
| Fluorochem | 10g | 1434.93 Pln | |
| Fluorochem | 25g | 2642.84 Pln | |
| Fluorochem | 100g | 9583.10 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 826.50 Pln | |
| Ambeed | 10g | 1388.31 Pln | |
| Ambeed | 25g | 2562.00 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(4S)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid (CAS 1095952-22-9) is a chemical compound with the molecular formula C23H24N2O6 and a molecular weight of 424.4 g/mol. IUPAC name: (4S)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid. InChIKey: XUBXHZJERGBCEL-IBGZPJMESA-N.
| Molecular formula | C23H24N2O6 |
|---|---|
| Molecular weight | 424.4 g/mol |
| IUPAC name | (4S)-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid |
| InChIKey | XUBXHZJERGBCEL-IBGZPJMESA-N |
| SMILES | CC1(N([C@@H](CO1)C(=O)O)C(=O)CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-Gly-Ser(Psi(Me,Me)Pro)-OH, Fmoc-Gly-Ser(Psime,Mepro)-OH, FMOC-GLU(OTBU)-THR(PSI-ME,MEPRO)-OH, orb1691972, Fmoc-Gly-Ser(|xMe, Mepro)-OH, Fmoc-Gly-Ser(Psi(Me ,Me)pro)-OH, Fmoc-Gly-L-Ser(Psi(Me,Me)pro)-OH, (9H-Fluoren-9-yl)MethOxy]Carbonyl Gly-Ser(Psi(Me,Me)Pro)-OH, Fmoc-Glu(OtBu)-Thr[Psi(Me,Me)Pro]-OH>/= 98.5% (HPLC), (9H-Fluoren-9-yl)MethOxy]Carbonyl Glu(OtBu)-ThrPsi(Me,Me)Pro-OH