cas: 797806-64-5 — see every product listed under this CAS number, including other names
4-Oxo-4-((5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl)amino)butanoic acid, 97% (CAS 797806-64-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A191672-10g |
| cas | 797806-64-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 19958.05 Pln | |
| AmBeed | 5g | 14287.84 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-oxo-4-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]butanoic acid (CAS 797806-64-5) is a chemical compound with the molecular formula C7H6F3N3O3S and a molecular weight of 269.20 g/mol. IUPAC name: 4-oxo-4-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]butanoic acid. InChIKey: PTYFZPOMQNHYHW-UHFFFAOYSA-N.
| Molecular formula | C7H6F3N3O3S |
|---|---|
| Molecular weight | 269.20 g/mol |
| IUPAC name | 4-oxo-4-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]butanoic acid |
| InChIKey | PTYFZPOMQNHYHW-UHFFFAOYSA-N |
| SMILES | C(CC(=O)O)C(=O)NC1=NN=C(S1)C(F)(F)F |
Computed by PubChem (NCBI)