CAS 519170-72-0 is the registry number for Ethyl oxo([5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 2-oxo-2-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]acetate (CAS 519170-72-0) is a chemical compound with the molecular formula C7H6F3N3O3S and a molecular weight of 269.20 g/mol. IUPAC name: ethyl 2-oxo-2-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]acetate. InChIKey: WCTZTHAVVADRAJ-UHFFFAOYSA-N.
| Molecular formula | C7H6F3N3O3S |
|---|---|
| Molecular weight | 269.20 g/mol |
| IUPAC name | ethyl 2-oxo-2-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]acetate |
| InChIKey | WCTZTHAVVADRAJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)NC1=NN=C(S1)C(F)(F)F |
Computed by PubChem (NCBI)