CAS 2243355-51-1 appears in our catalog under these names: 4-PQBH/ 99.08% (existing batch purity), 4–PQBH, 4-PQBH, 4-PQBH, 99.14%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 100mg, 25mg, 5mg, 50mg, 100 mg, 25 mg.
N-[(E)-pyridin-4-ylmethylideneamino]-4-(quinolin-4-ylamino)benzamide (CAS 2243355-51-1) is a chemical compound with the molecular formula C22H17N5O and a molecular weight of 367.4 g/mol. IUPAC name: N-[(E)-pyridin-4-ylmethylideneamino]-4-(quinolin-4-ylamino)benzamide. InChIKey: AVTFCFMDUCRAQC-MFKUBSTISA-N.
| Molecular formula | C22H17N5O |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | N-[(E)-pyridin-4-ylmethylideneamino]-4-(quinolin-4-ylamino)benzamide |
| InChIKey | AVTFCFMDUCRAQC-MFKUBSTISA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)NC3=CC=C(C=C3)C(=O)N/N=C/C4=CC=NC=C4 |
Computed by PubChem (NCBI)