4-Phenylpiperidin-4-ol hydrochloride, 95%
cas: 5004-94-4 — see every product listed under this CAS number, including other names
4-Phenylpiperidin-4-ol hydrochloride, 95% (CAS 5004-94-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g, 250mg, 25g. Offered by: Combi-blocks, Ambeed, BLDpharm, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | JD-6913-10g |
| cas | 5004-94-4 |
| size | 10g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 464.94 Pln | |
| Ambeed | 10g | 687.44 Pln | |
| Ambeed | 25g | 1616.38 Pln | |
| BLDpharm | 250mg | 181.07 Pln | |
| BLDpharm | 1g | 336.57 Pln | |
| BLDpharm | 5g | 675.34 Pln | |
| BLDpharm | 10g | 1041.88 Pln | |
| BLDpharm | 25g | 2008.21 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 323.60 Pln | |
| Chemat | 5g | 654.80 Pln | |
| Chemat | 10g | 1010.00 Pln | |
| Chemat | 25g | 2061.20 Pln | |
| Fluorochem | 5g | 1211.05 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-phenylpiperidin-4-ol;hydrochloride (CAS 5004-94-4) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 4-phenylpiperidin-4-ol;hydrochloride. InChIKey: SETKGOFWOWUIIE-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 4-phenylpiperidin-4-ol;hydrochloride |
| InChIKey | SETKGOFWOWUIIE-UHFFFAOYSA-N |
| SMILES | C1CNCCC1(C2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-phenylpiperidin-4-ol hydrochloride, 4-Hydroxy-4-phenylpiperidine hydrochloride, 4-phenylpiperidin-4-ol;hydrochloride, 4-Phenyl-4-piperidinol HCl, 4-Phenyl-4-piperidinol hydrochloride, 4-piperidinol,4-phenyl-,hydrochloride, orb3026168, 4-phenyl-4-hydroxypiperidine HCl, SETKGOFWOWUIIE-UHFFFAOYSA-N, 4-Phenyl-4-piperidinolhydrochloride