cas: 3884-31-9 — see every product listed under this CAS number, including other names
4-Phenylthiazol-2(3H)-one, 97%(LC-MS),RG, 97%(LC-MS),RG (CAS 3884-31-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11892B-250mg |
| cas | 3884-31-9 |
| size | 250mg |
| availability | 65g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 693.20 Pln |
| purity | 97%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
4-phenyl-3H-1,3-thiazol-2-one (CAS 3884-31-9) is a chemical compound with the molecular formula C9H7NOS and a molecular weight of 177.22 g/mol. IUPAC name: 4-phenyl-3H-1,3-thiazol-2-one. InChIKey: UXIWLHNMLDJWMF-UHFFFAOYSA-N.
| Molecular formula | C9H7NOS |
|---|---|
| Molecular weight | 177.22 g/mol |
| IUPAC name | 4-phenyl-3H-1,3-thiazol-2-one |
| InChIKey | UXIWLHNMLDJWMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=O)N2 |
Computed by PubChem (NCBI)