CAS 827-45-2 is the registry number for 2-Phenyl-1,3-thiazol-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
2-phenyl-1,3-thiazol-4-ol (CAS 827-45-2) is a chemical compound with the molecular formula C9H7NOS and a molecular weight of 177.22 g/mol. IUPAC name: 2-phenyl-1,3-thiazol-4-ol. InChIKey: CCMLIFHRMDXEBM-UHFFFAOYSA-N.
| Molecular formula | C9H7NOS |
|---|---|
| Molecular weight | 177.22 g/mol |
| IUPAC name | 2-phenyl-1,3-thiazol-4-ol |
| InChIKey | CCMLIFHRMDXEBM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CS2)O |
Computed by PubChem (NCBI)