CAS 89-08-7 appears in our catalog under these names: 4-Sulfophthalic acid, 50% in water, 95%, 4-Sulfophthalic acid, 98+%, 4-Sulfophthalic acid, 98%, 4-Sulfophthalic Acid (50% w/w aq. soln.) (may contain up to 20% 3-Sulfophthalic Acid), 4-Sulfophthalic Acid (contains 3-Sulfophthalic Acid) (ca. 50% in Water). Offered by: Combi-blocks, AmBeed, TRC, TCI, Fluorochem. Available pack sizes: 100g, 5g, 500g, 25g, 100ml, 250ml, 50ml, 25ml.
4-sulfophthalic acid (CAS 89-08-7) is a chemical compound with the molecular formula C8H6O7S and a molecular weight of 246.20 g/mol. IUPAC name: 4-sulfophthalic acid. InChIKey: WNKQDGLSQUASME-UHFFFAOYSA-N.
| Molecular formula | C8H6O7S |
|---|---|
| Molecular weight | 246.20 g/mol |
| IUPAC name | 4-sulfophthalic acid |
| InChIKey | WNKQDGLSQUASME-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)