cas: 1445993-86-1 — see every product listed under this CAS number, including other names
4-bromo-1-tosyl-1H-pyrrolo[2,3-c]pyridin-7(6H)-one, 98%, 98% (CAS 1445993-86-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DTSY-25g |
| cas | 1445993-86-1 |
| size | 25g |
| availability | 50g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 8915.60 Pln | |
| Chemat | 50g | 16298.00 Pln | |
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 544.40 Pln | |
| Chemat | 500mg | 750.80 Pln | |
| Chemat | 1g | 890.00 Pln | |
| Chemat | 5g | 2128.40 Pln | |
| Chemat | 10g | 3851.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-1-(4-methylphenyl)sulfonyl-6H-pyrrolo[2,3-c]pyridin-7-one (CAS 1445993-86-1) is a chemical compound with the molecular formula C14H11BrN2O3S and a molecular weight of 367.22 g/mol. IUPAC name: 4-bromo-1-(4-methylphenyl)sulfonyl-6H-pyrrolo[2,3-c]pyridin-7-one. InChIKey: IUXIDYNEPFEKIS-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN2O3S |
|---|---|
| Molecular weight | 367.22 g/mol |
| IUPAC name | 4-bromo-1-(4-methylphenyl)sulfonyl-6H-pyrrolo[2,3-c]pyridin-7-one |
| InChIKey | IUXIDYNEPFEKIS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2C(=O)NC=C3Br |
Computed by PubChem (NCBI)