CAS 1392484-71-7 is the registry number for 7-Bromo-3-(4-methoxybenzyl)thieno[3,2-d]pyrimidine-2,4(1h,3h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
7-bromo-3-[(4-methoxyphenyl)methyl]-1H-thieno[3,2-d]pyrimidine-2,4-dione (CAS 1392484-71-7) is a chemical compound with the molecular formula C14H11BrN2O3S and a molecular weight of 367.22 g/mol. IUPAC name: 7-bromo-3-[(4-methoxyphenyl)methyl]-1H-thieno[3,2-d]pyrimidine-2,4-dione. InChIKey: ZWVXWPNJBUJPPN-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN2O3S |
|---|---|
| Molecular weight | 367.22 g/mol |
| IUPAC name | 7-bromo-3-[(4-methoxyphenyl)methyl]-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| InChIKey | ZWVXWPNJBUJPPN-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C(=O)C3=C(C(=CS3)Br)NC2=O |
Computed by PubChem (NCBI)