cas: 676265-54-6 — see every product listed under this CAS number, including other names
4-bromo-2,3-dihydro-1H-inden-5-amine, ≥95%, ≥95% (CAS 676265-54-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FFPG-100mg |
| cas | 676265-54-6 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1614.80 Pln | |
| Chemat | 250mg | 1888.40 Pln | |
| Chemat | 5g | 8675.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2,3-dihydro-1H-inden-5-amine (CAS 676265-54-6) is a chemical compound with the molecular formula C9H10BrN and a molecular weight of 212.09 g/mol. IUPAC name: 4-bromo-2,3-dihydro-1H-inden-5-amine. InChIKey: IXKXAFPEOCHSQH-UHFFFAOYSA-N.
| Molecular formula | C9H10BrN |
|---|---|
| Molecular weight | 212.09 g/mol |
| IUPAC name | 4-bromo-2,3-dihydro-1H-inden-5-amine |
| InChIKey | IXKXAFPEOCHSQH-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=C(C=C2)N)Br |
Computed by PubChem (NCBI)