4-bromo-6-chloro-5-iodo-1H-indazole, 97%
cas: 2891597-77-4 — see every product listed under this CAS number, including other names
4-bromo-6-chloro-5-iodo-1H-indazole, 97% (CAS 2891597-77-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch138NZA-100mg |
| cas | 2891597-77-4 |
| size | 100mg |
| availability | 1400g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 453.20 Pln | |
| Chemat | 5g | 1230.80 Pln | |
| Chemat | 10g | 2008.40 Pln | |
| Chemat | 25g | 3957.20 Pln | |
| Chemat | 100g | 9587.60 Pln | |
| Fluorochem | 1g | 669.57 Pln | |
| Fluorochem | 5g | 1867.07 Pln | |
| Fluorochem | 10g | 3074.98 Pln | |
| Fluorochem | 25g | 6021.86 Pln | |
| Fluorochem | 100g | 14362.67 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-bromo-6-chloro-5-iodo-1H-indazole (CAS 2891597-77-4) is a chemical compound with the molecular formula C7H3BrClIN2 and a molecular weight of 357.37 g/mol. IUPAC name: 4-bromo-6-chloro-5-iodo-1H-indazole. InChIKey: YMNHGLKKZUDODW-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClIN2 |
|---|---|
| Molecular weight | 357.37 g/mol |
| IUPAC name | 4-bromo-6-chloro-5-iodo-1H-indazole |
| InChIKey | YMNHGLKKZUDODW-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=C1Cl)I)Br)C=NN2 |
Computed by PubChem (NCBI)