CAS 876343-87-2 is the registry number for 5-Bromo-4-chloro-2-iodo-1h-pyrrolo[2,3-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
5-bromo-4-chloro-2-iodo-1H-pyrrolo[2,3-b]pyridine (CAS 876343-87-2) is a chemical compound with the molecular formula C7H3BrClIN2 and a molecular weight of 357.37 g/mol. IUPAC name: 5-bromo-4-chloro-2-iodo-1H-pyrrolo[2,3-b]pyridine. InChIKey: UDHXQNMKGZFHBA-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClIN2 |
|---|---|
| Molecular weight | 357.37 g/mol |
| IUPAC name | 5-bromo-4-chloro-2-iodo-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | UDHXQNMKGZFHBA-UHFFFAOYSA-N |
| SMILES | C1=C(NC2=NC=C(C(=C21)Cl)Br)I |
Computed by PubChem (NCBI)