cas: 85967-19-7 — see every product listed under this CAS number, including other names
4-chloro-3-nitro-1,5-naphthyridine, 96%, 96% (CAS 85967-19-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H3JI-100mg |
| cas | 85967-19-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 688.40 Pln | |
| Chemat | 250mg | 899.60 Pln | |
| Chemat | 500mg | 1461.20 Pln | |
| Chemat | 1g | 2157.20 Pln | |
| Chemat | 5g | 7043.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
4-chloro-3-nitro-1,5-naphthyridine (CAS 85967-19-7) is a chemical compound with the molecular formula C8H4ClN3O2 and a molecular weight of 209.59 g/mol. IUPAC name: 4-chloro-3-nitro-1,5-naphthyridine. InChIKey: FDOIXMGDTOEUQL-UHFFFAOYSA-N.
| Molecular formula | C8H4ClN3O2 |
|---|---|
| Molecular weight | 209.59 g/mol |
| IUPAC name | 4-chloro-3-nitro-1,5-naphthyridine |
| InChIKey | FDOIXMGDTOEUQL-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C(=C2N=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)