CAS 75224-28-1 appears in our catalog under these names: 4-Chloro-5-nitroquinazoline, 95+%, 4-Chloro-5-nitroquinazoline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-chloro-5-nitroquinazoline (CAS 75224-28-1) is a chemical compound with the molecular formula C8H4ClN3O2 and a molecular weight of 209.59 g/mol. IUPAC name: 4-chloro-5-nitroquinazoline. InChIKey: DLSCGOLGMJZMMZ-UHFFFAOYSA-N.
| Molecular formula | C8H4ClN3O2 |
|---|---|
| Molecular weight | 209.59 g/mol |
| IUPAC name | 4-chloro-5-nitroquinazoline |
| InChIKey | DLSCGOLGMJZMMZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])C(=NC=N2)Cl |
Computed by PubChem (NCBI)