cas: 405230-97-9 — see every product listed under this CAS number, including other names
4-chloro-7-fluoro-3H-imidazo[4,5-c]pyridine, 95%, 95% (CAS 405230-97-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CLQB-100mg |
| cas | 405230-97-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 669.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-chloro-7-fluoro-3H-imidazo[4,5-c]pyridine (CAS 405230-97-9) is a chemical compound with the molecular formula C6H3ClFN3 and a molecular weight of 171.56 g/mol. IUPAC name: 4-chloro-7-fluoro-3H-imidazo[4,5-c]pyridine. InChIKey: DULUTDRRRDVDRY-UHFFFAOYSA-N.
| Molecular formula | C6H3ClFN3 |
|---|---|
| Molecular weight | 171.56 g/mol |
| IUPAC name | 4-chloro-7-fluoro-3H-imidazo[4,5-c]pyridine |
| InChIKey | DULUTDRRRDVDRY-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C(=N1)Cl)NC=N2)F |
Computed by PubChem (NCBI)