Products 1350648-42-8
CAS 1350648-42-8 appears in our catalog under these names: 7-chloro-6-fluoro-1H-pyrazolo[4,3-b]pyridine, 95%, 7-Chloro-6-fluoro-1H-pyrazolo[4,3-b]pyridine, 96%, 96%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg.
7-chloro-6-fluoro-1H-pyrazolo[4,3-b]pyridine (CAS 1350648-42-8) is a chemical compound with the molecular formula C6H3ClFN3 and a molecular weight of 171.56 g/mol. IUPAC name: 7-chloro-6-fluoro-1H-pyrazolo[4,3-b]pyridine. InChIKey: GQAYKWNERNFKAZ-UHFFFAOYSA-N.
| Molecular formula | C6H3ClFN3 |
|---|---|
| Molecular weight | 171.56 g/mol |
| IUPAC name | 7-chloro-6-fluoro-1H-pyrazolo[4,3-b]pyridine |
| InChIKey | GQAYKWNERNFKAZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C2C(=N1)C=NN2)Cl)F |
Computed by PubChem (NCBI)