cas: 63894-54-2 — see every product listed under this CAS number, including other names
4-hydrazinyl-5,6-dimethylthieno[2,3-d]pyrimidine, 97%, 97% (CAS 63894-54-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EE39-1g |
| cas | 63894-54-2 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 712.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine (CAS 63894-54-2) is a chemical compound with the molecular formula C8H10N4S and a molecular weight of 194.26 g/mol. IUPAC name: (5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine. InChIKey: CQLQBEQLDPCGHF-UHFFFAOYSA-N.
| Molecular formula | C8H10N4S |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | (5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine |
| InChIKey | CQLQBEQLDPCGHF-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=NC=NC(=C12)NN)C |
Computed by PubChem (NCBI)