CAS 63894-54-2 appears in our catalog under these names: (5,6-Dimethyl-thieno[2,3-d]pyrimidin-4-yl)-hydrazine, 95%, 4-Hydrazinyl-5,6-dimethylthieno(2,3-d)pyrimidine, 95+%, 4-hydrazinyl-5,6-dimethylthieno[2,3-d]pyrimidine, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 1g, 5g.
(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine (CAS 63894-54-2) is a chemical compound with the molecular formula C8H10N4S and a molecular weight of 194.26 g/mol. IUPAC name: (5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine. InChIKey: CQLQBEQLDPCGHF-UHFFFAOYSA-N.
| Molecular formula | C8H10N4S |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | (5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazine |
| InChIKey | CQLQBEQLDPCGHF-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=NC=NC(=C12)NN)C |
Computed by PubChem (NCBI)