cas: 889104-80-7 — see every product listed under this CAS number, including other names
4-methyl-5-pentylbenzene-1,3-diol, 95%, 95% (CAS 889104-80-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FFXR-100mg |
| cas | 889104-80-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 5574.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-methyl-5-pentylbenzene-1,3-diol is a resorcinol having methyl and pentyl groups at positions 4 and 5 respectively. It has a role as an antineoplastic agent.
Source: ChEBI
| Molecular formula | C12H18O2 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | 4-methyl-5-pentylbenzene-1,3-diol |
| InChIKey | CUXFFBBWEJOYAI-UHFFFAOYSA-N |
| SMILES | CCCCCC1=C(C(=CC(=C1)O)O)C |
Computed by PubChem (NCBI)