cas: 75908-75-7 — see every product listed under this CAS number, including other names
4-tert-Butyl-2,6-diiodophenol, 95%, 95% (CAS 75908-75-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116TC6-100mg |
| cas | 75908-75-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 376.40 Pln | |
| Chemat | 5g | 1000.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-tert-butyl-2,6-diiodophenol (CAS 75908-75-7) is a chemical compound with the molecular formula C10H12I2O and a molecular weight of 402.01 g/mol. IUPAC name: 4-tert-butyl-2,6-diiodophenol. InChIKey: CZMBOODZJMDOJH-UHFFFAOYSA-N.
| Molecular formula | C10H12I2O |
|---|---|
| Molecular weight | 402.01 g/mol |
| IUPAC name | 4-tert-butyl-2,6-diiodophenol |
| InChIKey | CZMBOODZJMDOJH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)I)O)I |
Computed by PubChem (NCBI)