CAS 75908-75-7 appears in our catalog under these names: 4-tert-Butyl-2,6-diiodophenol, 95%, 4-tert-Butyl-2,6-diiodophenol, 95%, 95%, 4-(tert-Butyl)-2,6-diiodophenol, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg.
4-tert-butyl-2,6-diiodophenol (CAS 75908-75-7) is a chemical compound with the molecular formula C10H12I2O and a molecular weight of 402.01 g/mol. IUPAC name: 4-tert-butyl-2,6-diiodophenol. InChIKey: CZMBOODZJMDOJH-UHFFFAOYSA-N.
| Molecular formula | C10H12I2O |
|---|---|
| Molecular weight | 402.01 g/mol |
| IUPAC name | 4-tert-butyl-2,6-diiodophenol |
| InChIKey | CZMBOODZJMDOJH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)I)O)I |
Computed by PubChem (NCBI)