CAS 328998-25-0 appears in our catalog under these names: 4E1rcat/ 99.36% (existing batch purity), 4E1RCat, 4E1RCat 98%, 4E1RCat, 98%, 98%, 4E1RCat, 99.04%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
4-[(3E)-3-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-2-oxo-5-phenylpyrrol-1-yl]benzoic acid (CAS 328998-25-0) is a chemical compound with the molecular formula C28H18N2O6 and a molecular weight of 478.5 g/mol. IUPAC name: 4-[(3E)-3-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-2-oxo-5-phenylpyrrol-1-yl]benzoic acid. InChIKey: BBQRBOIMSKMFFO-LTGZKZEYSA-N.
| Molecular formula | C28H18N2O6 |
|---|---|
| Molecular weight | 478.5 g/mol |
| IUPAC name | 4-[(3E)-3-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-2-oxo-5-phenylpyrrol-1-yl]benzoic acid |
| InChIKey | BBQRBOIMSKMFFO-LTGZKZEYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C/C(=C\C3=CC=C(O3)C4=CC=C(C=C4)[N+](=O)[O-])/C(=O)N2C5=CC=C(C=C5)C(=O)O |
Computed by PubChem (NCBI)