cas: 99840-54-7 — see every product listed under this CAS number, including other names
5,5'-Dimethyldipyrromethane, ≥98%, ≥98% (CAS 99840-54-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115X8H-100mg |
| cas | 99840-54-7 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 534.80 Pln | |
| Chemat | 250mg | 875.60 Pln | |
| Chemat | 1g | 2157.20 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
2-[2-(1H-pyrrol-2-yl)propan-2-yl]-1H-pyrrole (CAS 99840-54-7) is a chemical compound with the molecular formula C11H14N2 and a molecular weight of 174.24 g/mol. IUPAC name: 2-[2-(1H-pyrrol-2-yl)propan-2-yl]-1H-pyrrole. InChIKey: LATXIKIAELSWEJ-UHFFFAOYSA-N.
| Molecular formula | C11H14N2 |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 2-[2-(1H-pyrrol-2-yl)propan-2-yl]-1H-pyrrole |
| InChIKey | LATXIKIAELSWEJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CN1)C2=CC=CN2 |
Computed by PubChem (NCBI)