Products 99840-54-7
CAS 99840-54-7 appears in our catalog under these names: 5,5'-Dimethyldipyrromethane, 95%, 5,5'-Dimethyldipyrromethane, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg.
2-[2-(1H-pyrrol-2-yl)propan-2-yl]-1H-pyrrole (CAS 99840-54-7) is a chemical compound with the molecular formula C11H14N2 and a molecular weight of 174.24 g/mol. IUPAC name: 2-[2-(1H-pyrrol-2-yl)propan-2-yl]-1H-pyrrole. InChIKey: LATXIKIAELSWEJ-UHFFFAOYSA-N.
| Molecular formula | C11H14N2 |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 2-[2-(1H-pyrrol-2-yl)propan-2-yl]-1H-pyrrole |
| InChIKey | LATXIKIAELSWEJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CN1)C2=CC=CN2 |
Computed by PubChem (NCBI)