CAS 25884-43-9 is the registry number for 5,5'-Thiobis(isobenzofuran-1,3-dione), 90%, 90%. Offered by: Chemat. Available pack sizes: 25mg, 250mg, 1g, 5g, 50mg, 100mg.
5-[(1,3-dioxo-2-benzofuran-5-yl)sulfanyl]-2-benzofuran-1,3-dione (CAS 25884-43-9) is a chemical compound with the molecular formula C16H6O6S and a molecular weight of 326.3 g/mol. IUPAC name: 5-[(1,3-dioxo-2-benzofuran-5-yl)sulfanyl]-2-benzofuran-1,3-dione. InChIKey: PHCJRSXXXCZFPL-UHFFFAOYSA-N.
| Molecular formula | C16H6O6S |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | 5-[(1,3-dioxo-2-benzofuran-5-yl)sulfanyl]-2-benzofuran-1,3-dione |
| InChIKey | PHCJRSXXXCZFPL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1SC3=CC4=C(C=C3)C(=O)OC4=O)C(=O)OC2=O |
Computed by PubChem (NCBI)