Products 25884-43-9

CAS 25884-43-9 is the registry number for 5,5'-Thiobis(isobenzofuran-1,3-dione), 90%, 90%. Offered by: Chemat. Available pack sizes: 25mg, 250mg, 1g, 5g, 50mg, 100mg.

Structural formula: {0} (CAS {1})

5-[(1,3-dioxo-2-benzofuran-5-yl)sulfanyl]-2-benzofuran-1,3-dione (CAS 25884-43-9) is a chemical compound with the molecular formula C16H6O6S and a molecular weight of 326.3 g/mol. IUPAC name: 5-[(1,3-dioxo-2-benzofuran-5-yl)sulfanyl]-2-benzofuran-1,3-dione. InChIKey: PHCJRSXXXCZFPL-UHFFFAOYSA-N.

Identity
Molecular formulaC16H6O6S
Molecular weight326.3 g/mol
IUPAC name5-[(1,3-dioxo-2-benzofuran-5-yl)sulfanyl]-2-benzofuran-1,3-dione
InChIKeyPHCJRSXXXCZFPL-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1SC3=CC4=C(C=C3)C(=O)OC4=O)C(=O)OC2=O

Computed by PubChem (NCBI)