cas: 938080-25-2 — see every product listed under this CAS number, including other names
5,5-Dimethyl-2-(1-phenylvinyl)-1,3,2-dioxaborinane (CAS 938080-25-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218448-250MG |
| cas | 938080-25-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 5g | 1122.54 Pln |
| delivery time | 3-4 weeks |
|---|
5,5-dimethyl-2-(1-phenylethenyl)-1,3,2-dioxaborinane (CAS 938080-25-2) is a chemical compound with the molecular formula C13H17BO2 and a molecular weight of 216.09 g/mol. IUPAC name: 5,5-dimethyl-2-(1-phenylethenyl)-1,3,2-dioxaborinane. InChIKey: HNJLVOQORSGCLB-UHFFFAOYSA-N.
| Molecular formula | C13H17BO2 |
|---|---|
| Molecular weight | 216.09 g/mol |
| IUPAC name | 5,5-dimethyl-2-(1-phenylethenyl)-1,3,2-dioxaborinane |
| InChIKey | HNJLVOQORSGCLB-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C(=C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)