Products 938080-25-2
CAS 938080-25-2 appears in our catalog under these names: 5,5-Dimethyl-2-(1-phenylvinyl)-1,3,2-dioxaborinane, 1-Phenylvinylboronic acid, neopentyl glycol ester, 98%, 5,5-Dimethyl-2-(1-phenylvinyl)-1,3,2-dioxaborinane 98% mix TBC as stabilizer, 5,5-Dimethyl-2-(1-phenylvinyl)-1,3,2-dioxaborinane, 98% mix TBC as stabilizer, 98% mix TBC as stabilizer. Offered by: Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g.
5,5-dimethyl-2-(1-phenylethenyl)-1,3,2-dioxaborinane (CAS 938080-25-2) is a chemical compound with the molecular formula C13H17BO2 and a molecular weight of 216.09 g/mol. IUPAC name: 5,5-dimethyl-2-(1-phenylethenyl)-1,3,2-dioxaborinane. InChIKey: HNJLVOQORSGCLB-UHFFFAOYSA-N.
| Molecular formula | C13H17BO2 |
|---|---|
| Molecular weight | 216.09 g/mol |
| IUPAC name | 5,5-dimethyl-2-(1-phenylethenyl)-1,3,2-dioxaborinane |
| InChIKey | HNJLVOQORSGCLB-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C(=C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)