cas: 91994-11-5 — see every product listed under this CAS number, including other names
5,5-Dimethyl-2-(2-methylphenyl)-1,3,2-dioxaborinane, 95+%, 95+% (CAS 91994-11-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IGZ3-250mg |
| cas | 91994-11-5 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 434.00 Pln | |
| Chemat | 5g | 1480.40 Pln | |
| Chemat | 25g | 4077.20 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
5,5-dimethyl-2-(2-methylphenyl)-1,3,2-dioxaborinane (CAS 91994-11-5) is a chemical compound with the molecular formula C12H17BO2 and a molecular weight of 204.08 g/mol. IUPAC name: 5,5-dimethyl-2-(2-methylphenyl)-1,3,2-dioxaborinane. InChIKey: ZZYGMAWEGWFCCK-UHFFFAOYSA-N.
| Molecular formula | C12H17BO2 |
|---|---|
| Molecular weight | 204.08 g/mol |
| IUPAC name | 5,5-dimethyl-2-(2-methylphenyl)-1,3,2-dioxaborinane |
| InChIKey | ZZYGMAWEGWFCCK-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=CC=C2C |
Computed by PubChem (NCBI)