CAS 223799-24-4 appears in our catalog under these names: 5,5-Dimethyl-2-(3-methylphenyl)-1,3,2-dioxaborinane, 97%, 5,5-Dimethyl-2-m-tolyl-1,3,2-dioxaborinane, 95-<97%, 5,5-Dimethyl-2-m-tolyl-1,3,2-dioxaborinane, ≥97-<99%, 5,5–Dimethyl–2–(3–methylphenyl)–1,3,2–dioxaborinane, 5,5-Dimethyl-2-(3-methylphenyl)-1,3,2-dioxaborinane 95+%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 100g, 200g, 300g, 400g, 500g, 600g.
5,5-dimethyl-2-(3-methylphenyl)-1,3,2-dioxaborinane (CAS 223799-24-4) is a chemical compound with the molecular formula C12H17BO2 and a molecular weight of 204.08 g/mol. IUPAC name: 5,5-dimethyl-2-(3-methylphenyl)-1,3,2-dioxaborinane. InChIKey: FPHZOLPTFFTLBD-UHFFFAOYSA-N.
| Molecular formula | C12H17BO2 |
|---|---|
| Molecular weight | 204.08 g/mol |
| IUPAC name | 5,5-dimethyl-2-(3-methylphenyl)-1,3,2-dioxaborinane |
| InChIKey | FPHZOLPTFFTLBD-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC(=CC=C2)C |
Computed by PubChem (NCBI)