cas: 123470-47-3 — see every product listed under this CAS number, including other names
5,6-Difluoro-1H-benzo[d]imidazole-2(3H)-thione 95% (contains~7.0% solvent) (CAS 123470-47-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A820217-100mg |
| cas | 123470-47-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 392.62 Pln | |
| Ambeed | 250mg | 626.25 Pln | |
| Ambeed | 1g | 1594.12 Pln | |
| Ambeed | 5g | 4675.75 Pln |
| purity | 95% (contains~7.0% solvent) |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A820217 |
5,6-difluoro-1,3-dihydrobenzimidazole-2-thione (CAS 123470-47-3) is a chemical compound with the molecular formula C7H4F2N2S and a molecular weight of 186.18 g/mol. IUPAC name: 5,6-difluoro-1,3-dihydrobenzimidazole-2-thione. InChIKey: SPVMMWAWALXDSC-UHFFFAOYSA-N.
| Molecular formula | C7H4F2N2S |
|---|---|
| Molecular weight | 186.18 g/mol |
| IUPAC name | 5,6-difluoro-1,3-dihydrobenzimidazole-2-thione |
| InChIKey | SPVMMWAWALXDSC-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)NC(=S)N2 |
Computed by PubChem (NCBI)