cas: 123470-47-3 — see every product listed under this CAS number, including other names
5,6-Difluoro-1h-benzimidazole-2-thiol, 95%, 95% (CAS 123470-47-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111KO2-5g |
| cas | 123470-47-3 |
| size | 5g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 3592.40 Pln | |
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 472.40 Pln | |
| Chemat | 1g | 1182.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5,6-difluoro-1,3-dihydrobenzimidazole-2-thione (CAS 123470-47-3) is a chemical compound with the molecular formula C7H4F2N2S and a molecular weight of 186.18 g/mol. IUPAC name: 5,6-difluoro-1,3-dihydrobenzimidazole-2-thione. InChIKey: SPVMMWAWALXDSC-UHFFFAOYSA-N.
| Molecular formula | C7H4F2N2S |
|---|---|
| Molecular weight | 186.18 g/mol |
| IUPAC name | 5,6-difluoro-1,3-dihydrobenzimidazole-2-thione |
| InChIKey | SPVMMWAWALXDSC-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)NC(=S)N2 |
Computed by PubChem (NCBI)