cas: 18959-30-3 — see every product listed under this CAS number, including other names
5,6-Difluoroisobenzofuran-1,3-dione, 98% (CAS 18959-30-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113DSF-250mg |
| cas | 18959-30-3 |
| size | 250mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 232.40 Pln | |
| Chemat | 10g | 390.80 Pln | |
| Chemat | 25g | 856.40 Pln | |
| Chemat | 50g | 1509.20 Pln | |
| Chemat | 100g | 2819.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5,6-difluoro-2-benzofuran-1,3-dione (CAS 18959-30-3) is a chemical compound with the molecular formula C8H2F2O3 and a molecular weight of 184.10 g/mol. IUPAC name: 5,6-difluoro-2-benzofuran-1,3-dione. InChIKey: UATBWQQFLABWKR-UHFFFAOYSA-N.
| Molecular formula | C8H2F2O3 |
|---|---|
| Molecular weight | 184.10 g/mol |
| IUPAC name | 5,6-difluoro-2-benzofuran-1,3-dione |
| InChIKey | UATBWQQFLABWKR-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)C(=O)OC2=O |
Computed by PubChem (NCBI)