CAS 777860-08-9 is the registry number for 4,5-Difluoroisobenzofuran-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
4,5-difluoro-2-benzofuran-1,3-dione (CAS 777860-08-9) is a chemical compound with the molecular formula C8H2F2O3 and a molecular weight of 184.10 g/mol. IUPAC name: 4,5-difluoro-2-benzofuran-1,3-dione. InChIKey: HOLXVIZWJDORKM-UHFFFAOYSA-N.
| Molecular formula | C8H2F2O3 |
|---|---|
| Molecular weight | 184.10 g/mol |
| IUPAC name | 4,5-difluoro-2-benzofuran-1,3-dione |
| InChIKey | HOLXVIZWJDORKM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=O)OC2=O)F)F |
Computed by PubChem (NCBI)