cas: 312753-53-0 — see every product listed under this CAS number, including other names
5,6-diethyl-2,3-dihydro-1H-inden-2-amine Hydrochloride, 98%, 98% (CAS 312753-53-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118I2I-100mg |
| cas | 312753-53-0 |
| size | 100mg |
| availability | 700g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 227.60 Pln | |
| Chemat | 10g | 395.60 Pln | |
| Chemat | 25g | 741.20 Pln | |
| Chemat | 100g | 2781.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5,6-diethyl-2,3-dihydro-1H-inden-2-amine;hydrochloride (CAS 312753-53-0) is a chemical compound with the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. IUPAC name: 5,6-diethyl-2,3-dihydro-1H-inden-2-amine;hydrochloride. InChIKey: ZOVIYWYFBOQKIA-UHFFFAOYSA-N.
| Molecular formula | C13H20ClN |
|---|---|
| Molecular weight | 225.76 g/mol |
| IUPAC name | 5,6-diethyl-2,3-dihydro-1H-inden-2-amine;hydrochloride |
| InChIKey | ZOVIYWYFBOQKIA-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C2CC(CC2=C1)N)CC.Cl |
Computed by PubChem (NCBI)