5,7-Dichloro-2-(methylthio)thiazolo[4,5-d]pyrimidine, 98%
cas: 87789-35-3 — see every product listed under this CAS number, including other names
5,7-Dichloro-2-(methylthio)thiazolo[4,5-d]pyrimidine, 98% (CAS 87789-35-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F335328-50MG |
| cas | 87789-35-3 |
| size | 50mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 299.91 Pln | |
| Fluorochem | 100mg | 325.94 Pln | |
| Fluorochem | 250mg | 617.51 Pln | |
| Fluorochem | 1g | 1747.32 Pln | |
| Fluorochem | 5g | 2861.51 Pln | |
| Fluorochem | 10g | 5339.80 Pln | |
| Chemat | 50mg | 184.40 Pln | |
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 467.60 Pln | |
| Chemat | 1g | 1288.40 Pln | |
| Chemat | 5g | 1989.20 Pln | |
| Chemat | 10g | 3755.60 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
5,7-dichloro-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidine (CAS 87789-35-3) is a chemical compound with the molecular formula C6H3Cl2N3S2 and a molecular weight of 252.1 g/mol. IUPAC name: 5,7-dichloro-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidine. InChIKey: LGWQAKNSIYXJPN-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3S2 |
|---|---|
| Molecular weight | 252.1 g/mol |
| IUPAC name | 5,7-dichloro-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidine |
| InChIKey | LGWQAKNSIYXJPN-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(S1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
5,7-Dichloro-2-(methylthio)thiazolo[4,5-d]pyrimidine, 5,7-dichloro-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidine, C6H3Cl2N3S2, Thiazolo[4,5-d]pyrimidine, 5,7-dichloro-2-(methylthio)-, 5,7-dichloro-2-methylsulfanyl-thiazolo[4,5-d]pyrimidine, thio)thiazoL, Reaxys ID: 5537256, 5,7-dichloro-2-(methylthio)-Thiazolo[4,5-d]pyrimidine, 5,7-Dichloro-2-(methylsulfanyl)[1,3]thiazolo[4,5-d]pyrimidine