CAS 87789-35-3 appears in our catalog under these names: 5,7-Dichloro-2-(methylthio)thiazolo[4,5-d]pyrimidine, 95%, 5,7–Dichloro–2–(methylthio)thiazolo(4,5–d)pyrimidine, 5,7-Dichloro-2-(methylthio)thiazolo[4,5-d]pyrimidine, 98%, 98%, 5,7-Dichloro-2-(methylthio)thiazolo[4,5-d]pyrimidine, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 50mg, 5g, 10g.
5,7-dichloro-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidine (CAS 87789-35-3) is a chemical compound with the molecular formula C6H3Cl2N3S2 and a molecular weight of 252.1 g/mol. IUPAC name: 5,7-dichloro-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidine. InChIKey: LGWQAKNSIYXJPN-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3S2 |
|---|---|
| Molecular weight | 252.1 g/mol |
| IUPAC name | 5,7-dichloro-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidine |
| InChIKey | LGWQAKNSIYXJPN-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(S1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)