cas: 171850-30-9 — see every product listed under this CAS number, including other names
5,7-Dichloro-4-hydroxyquinoline-3-carboxylic acid, 97%, 97% (CAS 171850-30-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AQGL-100mg |
| cas | 171850-30-9 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 309.20 Pln | |
| Chemat | 5g | 808.40 Pln | |
| Chemat | 10g | 1302.80 Pln | |
| Chemat | 25g | 2541.20 Pln | |
| Chemat | 100g | 7504.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5,7-dichloro-4-oxo-1H-quinoline-3-carboxylic acid (CAS 171850-30-9) is a chemical compound with the molecular formula C10H5Cl2NO3 and a molecular weight of 258.05 g/mol. IUPAC name: 5,7-dichloro-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: DEBOCPZCSPMQBS-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO3 |
|---|---|
| Molecular weight | 258.05 g/mol |
| IUPAC name | 5,7-dichloro-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | DEBOCPZCSPMQBS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC=C(C2=O)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)