CAS 171850-30-9 appears in our catalog under these names: 5,7-Dichloro-4-hydroxyquinoline-3-carboxylic acid, 97%, 5,7-Dichloro-4-hydroxyquinoline-3-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, Chemat Brand, Chemat. Available pack sizes: 1g, 10g, 5g, on request, 100mg, 250mg, 25g, 100g.
5,7-dichloro-4-oxo-1H-quinoline-3-carboxylic acid (CAS 171850-30-9) is a chemical compound with the molecular formula C10H5Cl2NO3 and a molecular weight of 258.05 g/mol. IUPAC name: 5,7-dichloro-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: DEBOCPZCSPMQBS-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO3 |
|---|---|
| Molecular weight | 258.05 g/mol |
| IUPAC name | 5,7-dichloro-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | DEBOCPZCSPMQBS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC=C(C2=O)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)