cas: 2763157-90-8 — see every product listed under this CAS number, including other names
5,7-Dichloro-8-fluoro-2-(methylthio)pyrido[4,3-d]pyrimidin-4(3H)-one, 97%, 97% (CAS 2763157-90-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch135RWO-100mg |
| cas | 2763157-90-8 |
| size | 100mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 395.60 Pln | |
| Chemat | 10g | 712.40 Pln | |
| Chemat | 25g | 1398.80 Pln | |
| Chemat | 50g | 2598.80 Pln | |
| Chemat | 100g | 4230.80 Pln | |
| Chemat | 15g | 1010.00 Pln | |
| Chemat | 1kg | 16418.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5,7-dichloro-8-fluoro-2-methylsulfanyl-3H-pyrido[4,3-d]pyrimidin-4-one (CAS 2763157-90-8) is a chemical compound with the molecular formula C8H4Cl2FN3OS and a molecular weight of 280.11 g/mol. IUPAC name: 5,7-dichloro-8-fluoro-2-methylsulfanyl-3H-pyrido[4,3-d]pyrimidin-4-one. InChIKey: UVUILCJJGCRSNW-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2FN3OS |
|---|---|
| Molecular weight | 280.11 g/mol |
| IUPAC name | 5,7-dichloro-8-fluoro-2-methylsulfanyl-3H-pyrido[4,3-d]pyrimidin-4-one |
| InChIKey | UVUILCJJGCRSNW-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(C(=O)N1)C(=NC(=C2F)Cl)Cl |
Computed by PubChem (NCBI)