CAS 2904566-40-9 is the registry number for 2,7-Dichloro-8-fluoro-5-(methylthio)pyrido[4,3-d]pyrimidin-4(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,7-dichloro-8-fluoro-5-methylsulfanyl-3H-pyrido[4,3-d]pyrimidin-4-one (CAS 2904566-40-9) is a chemical compound with the molecular formula C8H4Cl2FN3OS and a molecular weight of 280.11 g/mol. IUPAC name: 2,7-dichloro-8-fluoro-5-methylsulfanyl-3H-pyrido[4,3-d]pyrimidin-4-one. InChIKey: DBCGCJGRMKQYAW-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2FN3OS |
|---|---|
| Molecular weight | 280.11 g/mol |
| IUPAC name | 2,7-dichloro-8-fluoro-5-methylsulfanyl-3H-pyrido[4,3-d]pyrimidin-4-one |
| InChIKey | DBCGCJGRMKQYAW-UHFFFAOYSA-N |
| SMILES | CSC1=NC(=C(C2=C1C(=O)NC(=N2)Cl)F)Cl |
Computed by PubChem (NCBI)