cas: 560088-89-3 — see every product listed under this CAS number, including other names
5,8,14,17-Tetraoxa-2,11-diazanonadecanedioic acid, 10-oxo-, 1-(9H-fluoren-9-ylmethyl) ester, 95%, 95% (CAS 560088-89-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DIEY-100mg |
| cas | 560088-89-3 |
| size | 100mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 10g | 683.60 Pln | |
| Chemat | 25g | 1096.40 Pln | |
| Chemat | 50g | 1782.80 Pln | |
| Chemat | 250g | 3006.80 Pln | |
| Chemat | 500g | 5366.40 Pln | |
| Chemat | 1kg | 10509.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-[[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid (CAS 560088-89-3) is a chemical compound with the molecular formula C27H34N2O9 and a molecular weight of 530.6 g/mol. IUPAC name: 2-[2-[2-[[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid. InChIKey: DYLGYEMUUDYFSV-UHFFFAOYSA-N.
| Molecular formula | C27H34N2O9 |
|---|---|
| Molecular weight | 530.6 g/mol |
| IUPAC name | 2-[2-[2-[[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid |
| InChIKey | DYLGYEMUUDYFSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCC(=O)NCCOCCOCC(=O)O |
Computed by PubChem (NCBI)