CAS 560088-89-3 appears in our catalog under these names: Fmoc-o2oc-o2oc-oh, 97%, Fmoc-O2Oc-O2Oc-OH, Fmoc-AEEAc-AEEAc-OH, Fmoc-AEEA-AEEA-OH 95%, 5,8,14,17-Tetraoxa-2,11-diazanonadecanedioic acid, 10-oxo-, 1-(9H-fluoren-9-ylmethyl) ester, 95%, 95%. Offered by: Combi-blocks, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 25g, 100g, 0,25g, 0,1g, 0,5g.
2-[2-[2-[[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid (CAS 560088-89-3) is a chemical compound with the molecular formula C27H34N2O9 and a molecular weight of 530.6 g/mol. IUPAC name: 2-[2-[2-[[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid. InChIKey: DYLGYEMUUDYFSV-UHFFFAOYSA-N.
| Molecular formula | C27H34N2O9 |
|---|---|
| Molecular weight | 530.6 g/mol |
| IUPAC name | 2-[2-[2-[[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid |
| InChIKey | DYLGYEMUUDYFSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCC(=O)NCCOCCOCC(=O)O |
Computed by PubChem (NCBI)