5,8-Dioxa-2,11-diazadodecanedioic acid, bis(1,1-dimethylethyl) ester, 97%
cas: 475591-59-4 — see every product listed under this CAS number, including other names
5,8-Dioxa-2,11-diazadodecanedioic acid, bis(1,1-dimethylethyl) ester, 97% (CAS 475591-59-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F863894-100MG |
| cas | 475591-59-4 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 1080.89 Pln | |
| Fluorochem | 10g | 2106.57 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethyl]carbamate (CAS 475591-59-4) is a chemical compound with the molecular formula C16H32N2O6 and a molecular weight of 348.43 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethyl]carbamate. InChIKey: IBOKAWABMPUDFK-UHFFFAOYSA-N.
| Molecular formula | C16H32N2O6 |
|---|---|
| Molecular weight | 348.43 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | IBOKAWABMPUDFK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Boc-NH-PEG2-NH-Boc, di-tert-butyl ((ethane-1,2-diylbis(oxy))bis(ethane-2,1-diyl))dicarbamate, 5,8-Dioxa-2,11-diazadodecanedioic acid, bis(1,1-dimethylethyl) ester, orb1989373, 1,8-Di-(tert-butoxycarbonylamino)-3,6-dioxaoctane, tert-butyl N-[2-[2-[2-(tert-butoxycarbonylamino)ethoxy]ethoxy]ethyl]carbamate